C21H18F4N2 — CID 19380596
5-(2,6-difluoro-4-pentylphenyl)-2-(3,5-difluorophenyl)pyrimidine (PubChem CID 19380596) has the molecular formula C21H18F4N2 and a molecular weight of 374.38 g/mol. Its IUPAC name is 5-(2,6-difluoro-4-pentylphenyl)-2-(3,5-difluorophenyl)pyrimidine.
| Compound Name | 5-(2,6-difluoro-4-pentylphenyl)-2-(3,5-difluorophenyl)pyrimidine |
|---|---|
| PubChem CID | 19380596 |
| Molecular Formula | C21H18F4N2 |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 5-(2,6-difluoro-4-pentylphenyl)-2-(3,5-difluorophenyl)pyrimidine |
| SMILES | CCCCCc1cc(F)c(-c2cnc(-c3cc(F)cc(F)c3)nc2)c(F)c1 |
| InChI | InChI=1S/C21H18F4N2/c1-2-3-4-5-13-6-18(24)20(19(25)7-13)15-11-26-21(27-12-15)14-8-16(22)10-17(23)9-14/h6-12H,2-5H2,1H3 |
| InChIKey | NRLGJDSGJGLEGB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|