C24H24F4N2 — CID 20708824
2-[4-(3,5-difluoro-4-methylphenyl)-3,5-difluorophenyl]-5-heptylpyrimidine (PubChem CID 20708824) has the molecular formula C24H24F4N2 and a molecular weight of 416.46 g/mol. Its IUPAC name is 2-[4-(3,5-difluoro-4-methylphenyl)-3,5-difluorophenyl]-5-heptylpyrimidine.
| Compound Name | 2-[4-(3,5-difluoro-4-methylphenyl)-3,5-difluorophenyl]-5-heptylpyrimidine |
|---|---|
| PubChem CID | 20708824 |
| Molecular Formula | C24H24F4N2 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 2-[4-(3,5-difluoro-4-methylphenyl)-3,5-difluorophenyl]-5-heptylpyrimidine |
| SMILES | CCCCCCCc1cnc(-c2cc(F)c(-c3cc(F)c(C)c(F)c3)c(F)c2)nc1 |
| InChI | InChI=1S/C24H24F4N2/c1-3-4-5-6-7-8-16-13-29-24(30-14-16)18-11-21(27)23(22(28)12-18)17-9-19(25)15(2)20(26)10-17/h9-14H,3-8H2,1-2H3 |
| InChIKey | HDUCLEQLUUMYRN-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|