C22H17F7N2 — CID 118501440
2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3,5-difluorophenyl]-5-pentylpyrimidine (PubChem CID 118501440) has the molecular formula C22H17F7N2 and a molecular weight of 442.38 g/mol. Its IUPAC name is 2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3,5-difluorophenyl]-5-pentylpyrimidine.
| Compound Name | 2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3,5-difluorophenyl]-5-pentylpyrimidine |
|---|---|
| PubChem CID | 118501440 |
| Molecular Formula | C22H17F7N2 |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3,5-difluorophenyl]-5-pentylpyrimidine |
| SMILES | CCCCCc1cnc(-c2cc(F)c(-c3cc(F)c(C(F)(F)F)c(F)c3)c(F)c2)nc1 |
| InChI | InChI=1S/C22H17F7N2/c1-2-3-4-5-12-10-30-21(31-11-12)14-8-15(23)19(16(24)9-14)13-6-17(25)20(18(26)7-13)22(27,28)29/h6-11H,2-5H2,1H3 |
| InChIKey | XWCOMHVOAVYERP-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|