C22H18F6N2O — CID 18348269
2-[3,5-difluoro-4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-5-pentylpyrimidine (PubChem CID 18348269) has the molecular formula C22H18F6N2O and a molecular weight of 440.39 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-5-pentylpyrimidine.
| Compound Name | 2-[3,5-difluoro-4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-5-pentylpyrimidine |
|---|---|
| PubChem CID | 18348269 |
| Molecular Formula | C22H18F6N2O |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 2-[3,5-difluoro-4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-5-pentylpyrimidine |
| SMILES | CCCCCc1cnc(-c2cc(F)c(-c3ccc(OC(F)(F)F)c(F)c3)c(F)c2)nc1 |
| InChI | InChI=1S/C22H18F6N2O/c1-2-3-4-5-13-11-29-21(30-12-13)15-9-17(24)20(18(25)10-15)14-6-7-19(16(23)8-14)31-22(26,27)28/h6-12H,2-5H2,1H3 |
| InChIKey | AFNXIXFXBIVDOY-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|