C22H17F4N3 — CID 19380602
4-[2,6-difluoro-4-(5-pentylpyrimidin-2-yl)phenyl]-2,5-difluorobenzonitrile (PubChem CID 19380602) has the molecular formula C22H17F4N3 and a molecular weight of 399.39 g/mol. Its IUPAC name is 4-[2,6-difluoro-4-(5-pentylpyrimidin-2-yl)phenyl]-2,5-difluorobenzonitrile.
| Compound Name | 4-[2,6-difluoro-4-(5-pentylpyrimidin-2-yl)phenyl]-2,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 19380602 |
| Molecular Formula | C22H17F4N3 |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 4-[2,6-difluoro-4-(5-pentylpyrimidin-2-yl)phenyl]-2,5-difluorobenzonitrile |
| SMILES | CCCCCc1cnc(-c2cc(F)c(-c3cc(F)c(C#N)cc3F)c(F)c2)nc1 |
| InChI | InChI=1S/C22H17F4N3/c1-2-3-4-5-13-11-28-22(29-12-13)14-6-19(25)21(20(26)7-14)16-9-17(23)15(10-27)8-18(16)24/h6-9,11-12H,2-5H2,1H3 |
| InChIKey | MOZQFFAMVVMYFQ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|