C25H20F5N — CID 144975699
2-[2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]phenyl]ethynyl]-5-pentylpyridine (PubChem CID 144975699) has the molecular formula C25H20F5N and a molecular weight of 429.43 g/mol. Its IUPAC name is 2-[2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]phenyl]ethynyl]-5-pentylpyridine.
| Compound Name | 2-[2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]phenyl]ethynyl]-5-pentylpyridine |
|---|---|
| PubChem CID | 144975699 |
| Molecular Formula | C25H20F5N |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 2-[2-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]phenyl]ethynyl]-5-pentylpyridine |
| SMILES | CCCCCc1ccc(C#Cc2ccc(-c3cc(F)c(C(F)(F)F)c(F)c3)cc2)nc1 |
| InChI | InChI=1S/C25H20F5N/c1-2-3-4-5-18-9-13-21(31-16-18)12-8-17-6-10-19(11-7-17)20-14-22(26)24(23(27)15-20)25(28,29)30/h6-7,9-11,13-16H,2-5H2,1H3 |
| InChIKey | DOGGKMYMLNASOR-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|