C24H16F7NO — CID 129036375
5-butyl-2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]pyridine (PubChem CID 129036375) has the molecular formula C24H16F7NO and a molecular weight of 467.38 g/mol. Its IUPAC name is 5-butyl-2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]pyridine.
| Compound Name | 5-butyl-2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]pyridine |
|---|---|
| PubChem CID | 129036375 |
| Molecular Formula | C24H16F7NO |
| Molecular Weight | 467.38 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 5-butyl-2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]pyridine |
| SMILES | CCCCc1ccc(C#Cc2cc(F)c(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2)nc1 |
| InChI | InChI=1S/C24H16F7NO/c1-2-3-4-14-5-7-16(32-13-14)8-6-15-9-18(25)22(19(26)10-15)24(30,31)33-17-11-20(27)23(29)21(28)12-17/h5,7,9-13H,2-4H2,1H3 |
| InChIKey | HEIZWUZVSSFRDI-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.38 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|