C33H18F10O2 — CID 129037576
5-butoxy-2-[[4-[2-[3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenyl]ethynyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluorobenzene (PubChem CID 129037576) has the molecular formula C33H18F10O2 and a molecular weight of 636.49 g/mol. Its IUPAC name is 5-butoxy-2-[[4-[2-[3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenyl]ethynyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluorobenzene.
| Compound Name | 5-butoxy-2-[[4-[2-[3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenyl]ethynyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 129037576 |
| Molecular Formula | C33H18F10O2 |
| Molecular Weight | 636.49 g/mol |
| Exact Mass | 636.11 |
| IUPAC Name | 5-butoxy-2-[[4-[2-[3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenyl]ethynyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluorobenzene |
| SMILES | CCCCOc1cc(F)c(C(F)(F)Oc2ccc(C#Cc3cc(F)c(C#Cc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C33H18F10O2/c1-2-3-10-44-22-16-27(37)31(28(38)17-22)33(42,43)45-21-8-7-20(24(34)15-21)6-4-18-11-25(35)23(26(36)12-18)9-5-19-13-29(39)32(41)30(40)14-19/h7-8,11-17H,2-3,10H2,1H3 |
| InChIKey | NJAQWDMIVVAFKQ-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.49 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|