C32H19F11O2 — CID 129036723
5-[2-(4-butoxy-2-fluorophenyl)ethynyl]-2-[[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluorobenzene (PubChem CID 129036723) has the molecular formula C32H19F11O2 and a molecular weight of 644.48 g/mol. Its IUPAC name is 5-[2-(4-butoxy-2-fluorophenyl)ethynyl]-2-[[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluorobenzene.
| Compound Name | 5-[2-(4-butoxy-2-fluorophenyl)ethynyl]-2-[[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 129036723 |
| Molecular Formula | C32H19F11O2 |
| Molecular Weight | 644.48 g/mol |
| Exact Mass | 644.12 |
| IUPAC Name | 5-[2-(4-butoxy-2-fluorophenyl)ethynyl]-2-[[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluorobenzene |
| SMILES | CCCCOc1ccc(C#Cc2cc(F)c(C(F)(F)Oc3ccc(-c4cc(F)c(C(F)(F)F)c(F)c4)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C32H19F11O2/c1-2-3-10-44-20-7-6-18(23(33)15-20)5-4-17-11-25(35)30(26(36)12-17)32(42,43)45-21-8-9-22(24(34)16-21)19-13-27(37)29(28(38)14-19)31(39,40)41/h6-9,11-16H,2-3,10H2,1H3 |
| InChIKey | XOECGZFMZWWAFC-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.48 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|