C34H18F10O — CID 129036323
2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-1,3-difluoro-5-[2-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]ethynyl]benzene (PubChem CID 129036323) has the molecular formula C34H18F10O and a molecular weight of 632.50 g/mol. Its IUPAC name is 2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-1,3-difluoro-5-[2-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]ethynyl]benzene.
| Compound Name | 2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-1,3-difluoro-5-[2-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 129036323 |
| Molecular Formula | C34H18F10O |
| Molecular Weight | 632.50 g/mol |
| Exact Mass | 632.12 |
| IUPAC Name | 2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-1,3-difluoro-5-[2-[2-fluoro-4-[(E)-pent-3-enyl]phenyl]ethynyl]benzene |
| SMILES | C/C=C/CCc1ccc(C#Cc2cc(F)c(C#Cc3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C34H18F10O/c1-2-3-4-5-19-6-9-22(25(35)12-19)10-7-20-13-26(36)24(27(37)14-20)11-8-21-15-28(38)32(29(39)16-21)34(43,44)45-23-17-30(40)33(42)31(41)18-23/h2-3,6,9,12-18H,4-5H2,1H3/b3-2+ |
| InChIKey | WMCHTVKKORYGIU-NSCUHMNNSA-N |
| XLogP | 9.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.50 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|