C33H17ClF8O — CID 129037120
5-[2-(4-but-3-enyl-2-fluorophenyl)ethynyl]-2-[[4-[2-(3-chloro-4,5-difluorophenyl)ethynyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluorobenzene (PubChem CID 129037120) has the molecular formula C33H17ClF8O and a molecular weight of 616.94 g/mol. Its IUPAC name is 5-[2-(4-but-3-enyl-2-fluorophenyl)ethynyl]-2-[[4-[2-(3-chloro-4,5-difluorophenyl)ethynyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluorobenzene.
| Compound Name | 5-[2-(4-but-3-enyl-2-fluorophenyl)ethynyl]-2-[[4-[2-(3-chloro-4,5-difluorophenyl)ethynyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 129037120 |
| Molecular Formula | C33H17ClF8O |
| Molecular Weight | 616.94 g/mol |
| Exact Mass | 616.08 |
| IUPAC Name | 5-[2-(4-but-3-enyl-2-fluorophenyl)ethynyl]-2-[[4-[2-(3-chloro-4,5-difluorophenyl)ethynyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluorobenzene |
| SMILES | C=CCCc1ccc(C#Cc2cc(F)c(C(F)(F)Oc3ccc(C#Cc4cc(F)c(F)c(Cl)c4)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C33H17ClF8O/c1-2-3-4-19-5-8-22(26(35)14-19)10-7-21-15-28(37)31(29(38)16-21)33(41,42)43-24-12-11-23(27(36)18-24)9-6-20-13-25(34)32(40)30(39)17-20/h2,5,8,11-18H,1,3-4H2 |
| InChIKey | UBFVZMBVODBGNN-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.94 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|