C33H17F9O — CID 129036864
5-[2-(4-but-3-enylphenyl)ethynyl]-2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-1,3-difluorobenzene (PubChem CID 129036864) has the molecular formula C33H17F9O and a molecular weight of 600.48 g/mol. Its IUPAC name is 5-[2-(4-but-3-enylphenyl)ethynyl]-2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-1,3-difluorobenzene.
| Compound Name | 5-[2-(4-but-3-enylphenyl)ethynyl]-2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 129036864 |
| Molecular Formula | C33H17F9O |
| Molecular Weight | 600.48 g/mol |
| Exact Mass | 600.11 |
| IUPAC Name | 5-[2-(4-but-3-enylphenyl)ethynyl]-2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-1,3-difluorobenzene |
| SMILES | C=CCCc1ccc(C#Cc2cc(F)c(C#Cc3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C33H17F9O/c1-2-3-4-19-5-7-20(8-6-19)9-10-21-13-25(34)24(26(35)14-21)12-11-22-15-27(36)31(28(37)16-22)33(41,42)43-23-17-29(38)32(40)30(39)18-23/h2,5-8,13-18H,1,3-4H2 |
| InChIKey | MKIZMPZUSGZSCL-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.48 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|