C33H19F7O — CID 129036359
5-[[4-[2-(4-but-3-enylphenyl)ethynyl]phenyl]-difluoromethoxy]-1,3-difluoro-2-[2-(3,4,5-trifluorophenyl)ethynyl]benzene (PubChem CID 129036359) has the molecular formula C33H19F7O and a molecular weight of 564.50 g/mol. Its IUPAC name is 5-[[4-[2-(4-but-3-enylphenyl)ethynyl]phenyl]-difluoromethoxy]-1,3-difluoro-2-[2-(3,4,5-trifluorophenyl)ethynyl]benzene.
| Compound Name | 5-[[4-[2-(4-but-3-enylphenyl)ethynyl]phenyl]-difluoromethoxy]-1,3-difluoro-2-[2-(3,4,5-trifluorophenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 129036359 |
| Molecular Formula | C33H19F7O |
| Molecular Weight | 564.50 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | 5-[[4-[2-(4-but-3-enylphenyl)ethynyl]phenyl]-difluoromethoxy]-1,3-difluoro-2-[2-(3,4,5-trifluorophenyl)ethynyl]benzene |
| SMILES | C=CCCc1ccc(C#Cc2ccc(C(F)(F)Oc3cc(F)c(C#Cc4cc(F)c(F)c(F)c4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C33H19F7O/c1-2-3-4-21-5-7-22(8-6-21)9-10-23-11-14-25(15-12-23)33(39,40)41-26-19-28(34)27(29(35)20-26)16-13-24-17-30(36)32(38)31(37)18-24/h2,5-8,11-12,14-15,17-20H,1,3-4H2 |
| InChIKey | IGKDMYRDERRCHN-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.50 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|