C32H17F9N2O2 — CID 129037496
5-but-3-enyl-2-[2-[4-[[4-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-3,5-difluorophenoxy]-difluoromethyl]phenyl]ethynyl]pyrimidine (PubChem CID 129037496) has the molecular formula C32H17F9N2O2 and a molecular weight of 632.48 g/mol. Its IUPAC name is 5-but-3-enyl-2-[2-[4-[[4-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-3,5-difluorophenoxy]-difluoromethyl]phenyl]ethynyl]pyrimidine.
| Compound Name | 5-but-3-enyl-2-[2-[4-[[4-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-3,5-difluorophenoxy]-difluoromethyl]phenyl]ethynyl]pyrimidine |
|---|---|
| PubChem CID | 129037496 |
| Molecular Formula | C32H17F9N2O2 |
| Molecular Weight | 632.48 g/mol |
| Exact Mass | 632.11 |
| IUPAC Name | 5-but-3-enyl-2-[2-[4-[[4-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-3,5-difluorophenoxy]-difluoromethyl]phenyl]ethynyl]pyrimidine |
| SMILES | C=CCCc1cnc(C#Cc2ccc(C(F)(F)Oc3cc(F)c(C#Cc4cc(F)c(OC(F)(F)F)c(F)c4)c(F)c3)cc2)nc1 |
| InChI | InChI=1S/C32H17F9N2O2/c1-2-3-4-21-17-42-29(43-18-21)12-8-19-5-9-22(10-6-19)31(37,38)44-23-15-25(33)24(26(34)16-23)11-7-20-13-27(35)30(28(36)14-20)45-32(39,40)41/h2,5-6,9-10,13-18H,1,3-4H2 |
| InChIKey | RZHMUUFJXQJXNI-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.48 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|