C31H20F10N2O2 — CID 129036463
2-[4-[[4-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-3,5-difluorophenoxy]-difluoromethyl]-3-fluorophenyl]-5-pentylpyrimidine (PubChem CID 129036463) has the molecular formula C31H20F10N2O2 and a molecular weight of 642.49 g/mol. Its IUPAC name is 2-[4-[[4-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-3,5-difluorophenoxy]-difluoromethyl]-3-fluorophenyl]-5-pentylpyrimidine.
| Compound Name | 2-[4-[[4-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-3,5-difluorophenoxy]-difluoromethyl]-3-fluorophenyl]-5-pentylpyrimidine |
|---|---|
| PubChem CID | 129036463 |
| Molecular Formula | C31H20F10N2O2 |
| Molecular Weight | 642.49 g/mol |
| Exact Mass | 642.14 |
| IUPAC Name | 2-[4-[[4-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-3,5-difluorophenoxy]-difluoromethyl]-3-fluorophenyl]-5-pentylpyrimidine |
| SMILES | CCCCCc1cnc(-c2ccc(C(F)(F)Oc3cc(F)c(C#Cc4cc(F)c(OC(F)(F)F)c(F)c4)c(F)c3)c(F)c2)nc1 |
| InChI | InChI=1S/C31H20F10N2O2/c1-2-3-4-5-18-15-42-29(43-16-18)19-7-9-22(25(34)12-19)30(37,38)44-20-13-23(32)21(24(33)14-20)8-6-17-10-26(35)28(27(36)11-17)45-31(39,40)41/h7,9-16H,2-5H2,1H3 |
| InChIKey | FTBWIKGKZGKIOJ-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.49 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|