C34H20F10O — CID 129037506
2-[2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl]ethynyl]-3,5-difluorophenyl]ethynyl]-1,3-difluoro-5-pentylbenzene (PubChem CID 129037506) has the molecular formula C34H20F10O and a molecular weight of 634.51 g/mol. Its IUPAC name is 2-[2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl]ethynyl]-3,5-difluorophenyl]ethynyl]-1,3-difluoro-5-pentylbenzene.
| Compound Name | 2-[2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl]ethynyl]-3,5-difluorophenyl]ethynyl]-1,3-difluoro-5-pentylbenzene |
|---|---|
| PubChem CID | 129037506 |
| Molecular Formula | C34H20F10O |
| Molecular Weight | 634.51 g/mol |
| Exact Mass | 634.14 |
| IUPAC Name | 2-[2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl]ethynyl]-3,5-difluorophenyl]ethynyl]-1,3-difluoro-5-pentylbenzene |
| SMILES | CCCCCc1cc(F)c(C#Cc2cc(F)c(C#Cc3ccc(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C34H20F10O/c1-2-3-4-5-20-13-26(35)24(27(36)14-20)10-7-21-15-28(37)23(29(38)16-21)9-6-19-8-11-25(30(39)12-19)34(43,44)45-22-17-31(40)33(42)32(41)18-22/h8,11-18H,2-5H2,1H3 |
| InChIKey | MVOKCCIHPIJJHG-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.51 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|