C37H26F8O — CID 134371231
2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-3-fluoro-5-methylphenyl]-6-pentylnaphthalene (PubChem CID 134371231) has the molecular formula C37H26F8O and a molecular weight of 638.60 g/mol. Its IUPAC name is 2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-3-fluoro-5-methylphenyl]-6-pentylnaphthalene.
| Compound Name | 2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-3-fluoro-5-methylphenyl]-6-pentylnaphthalene |
|---|---|
| PubChem CID | 134371231 |
| Molecular Formula | C37H26F8O |
| Molecular Weight | 638.60 g/mol |
| Exact Mass | 638.19 |
| IUPAC Name | 2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-3-fluoro-5-methylphenyl]-6-pentylnaphthalene |
| SMILES | CCCCCc1ccc2cc(-c3cc(C)c(C#Cc4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)ccc2c1 |
| InChI | InChI=1S/C37H26F8O/c1-3-4-5-6-22-7-9-25-17-26(11-10-24(25)14-22)27-13-21(2)29(30(38)18-27)12-8-23-15-31(39)35(32(40)16-23)37(44,45)46-28-19-33(41)36(43)34(42)20-28/h7,9-11,13-20H,3-6H2,1-2H3 |
| InChIKey | WNLMEBMJSQHINB-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.60 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|