C36H23F9O — CID 134371233
6-[[4-[2-[4-(4-butylphenyl)-2-fluoro-6-methylphenyl]ethynyl]-2,6-difluorophenyl]-difluoromethoxy]-1,2,3,8-tetrafluoronaphthalene (PubChem CID 134371233) has the molecular formula C36H23F9O and a molecular weight of 642.56 g/mol. Its IUPAC name is 6-[[4-[2-[4-(4-butylphenyl)-2-fluoro-6-methylphenyl]ethynyl]-2,6-difluorophenyl]-difluoromethoxy]-1,2,3,8-tetrafluoronaphthalene.
| Compound Name | 6-[[4-[2-[4-(4-butylphenyl)-2-fluoro-6-methylphenyl]ethynyl]-2,6-difluorophenyl]-difluoromethoxy]-1,2,3,8-tetrafluoronaphthalene |
|---|---|
| PubChem CID | 134371233 |
| Molecular Formula | C36H23F9O |
| Molecular Weight | 642.56 g/mol |
| Exact Mass | 642.16 |
| IUPAC Name | 6-[[4-[2-[4-(4-butylphenyl)-2-fluoro-6-methylphenyl]ethynyl]-2,6-difluorophenyl]-difluoromethoxy]-1,2,3,8-tetrafluoronaphthalene |
| SMILES | CCCCc1ccc(-c2cc(C)c(C#Cc3cc(F)c(C(F)(F)Oc4cc(F)c5c(F)c(F)c(F)cc5c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C36H23F9O/c1-3-4-5-20-6-9-22(10-7-20)23-12-19(2)26(27(37)16-23)11-8-21-13-29(39)33(30(40)14-21)36(44,45)46-25-15-24-17-31(41)34(42)35(43)32(24)28(38)18-25/h6-7,9-10,12-18H,3-5H2,1-2H3 |
| InChIKey | YPYWWWVMUYQDCX-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.56 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|