C42H26F10O2 — CID 134371400
6-[4-(4-butylphenyl)-2-fluorophenyl]-2-[difluoro-[3-fluoro-5-methoxy-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenoxy]methyl]-1,3,8-trifluoronaphthalene (PubChem CID 134371400) has the molecular formula C42H26F10O2 and a molecular weight of 752.65 g/mol. Its IUPAC name is 6-[4-(4-butylphenyl)-2-fluorophenyl]-2-[difluoro-[3-fluoro-5-methoxy-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenoxy]methyl]-1,3,8-trifluoronaphthalene.
| Compound Name | 6-[4-(4-butylphenyl)-2-fluorophenyl]-2-[difluoro-[3-fluoro-5-methoxy-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenoxy]methyl]-1,3,8-trifluoronaphthalene |
|---|---|
| PubChem CID | 134371400 |
| Molecular Formula | C42H26F10O2 |
| Molecular Weight | 752.65 g/mol |
| Exact Mass | 752.18 |
| IUPAC Name | 6-[4-(4-butylphenyl)-2-fluorophenyl]-2-[difluoro-[3-fluoro-5-methoxy-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenoxy]methyl]-1,3,8-trifluoronaphthalene |
| SMILES | CCCCc1ccc(-c2ccc(-c3cc(F)c4c(F)c(C(F)(F)Oc5cc(F)c(C#Cc6cc(F)c(F)c(F)c6)c(OC)c5)c(F)cc4c3)c(F)c2)cc1 |
| InChI | InChI=1S/C42H26F10O2/c1-3-4-5-22-6-9-24(10-7-22)25-11-13-29(31(43)17-25)26-16-27-19-34(46)39(41(50)38(27)33(45)18-26)42(51,52)54-28-20-32(44)30(37(21-28)53-2)12-8-23-14-35(47)40(49)36(48)15-23/h6-7,9-11,13-21H,3-5H2,1-2H3 |
| InChIKey | XKKTWLVIEYTUCP-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.65 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|