C42H26F10O — CID 134371374
6-[[4-[4-[2-[4-(4-butylphenyl)-2-fluorophenyl]ethynyl]-2-fluoro-5-methylphenyl]-2,6-difluorophenyl]-difluoromethoxy]-1,2,3,8-tetrafluoronaphthalene (PubChem CID 134371374) has the molecular formula C42H26F10O and a molecular weight of 736.65 g/mol. Its IUPAC name is 6-[[4-[4-[2-[4-(4-butylphenyl)-2-fluorophenyl]ethynyl]-2-fluoro-5-methylphenyl]-2,6-difluorophenyl]-difluoromethoxy]-1,2,3,8-tetrafluoronaphthalene.
| Compound Name | 6-[[4-[4-[2-[4-(4-butylphenyl)-2-fluorophenyl]ethynyl]-2-fluoro-5-methylphenyl]-2,6-difluorophenyl]-difluoromethoxy]-1,2,3,8-tetrafluoronaphthalene |
|---|---|
| PubChem CID | 134371374 |
| Molecular Formula | C42H26F10O |
| Molecular Weight | 736.65 g/mol |
| Exact Mass | 736.18 |
| IUPAC Name | 6-[[4-[4-[2-[4-(4-butylphenyl)-2-fluorophenyl]ethynyl]-2-fluoro-5-methylphenyl]-2,6-difluorophenyl]-difluoromethoxy]-1,2,3,8-tetrafluoronaphthalene |
| SMILES | CCCCc1ccc(-c2ccc(C#Cc3cc(F)c(-c4cc(F)c(C(F)(F)Oc5cc(F)c6c(F)c(F)c(F)cc6c5)c(F)c4)cc3C)c(F)c2)cc1 |
| InChI | InChI=1S/C42H26F10O/c1-3-4-5-23-6-8-24(9-7-23)27-13-11-25(32(43)17-27)10-12-26-16-33(44)31(14-22(26)2)28-18-35(46)39(36(47)19-28)42(51,52)53-30-15-29-20-37(48)40(49)41(50)38(29)34(45)21-30/h6-9,11,13-21H,3-5H2,1-2H3 |
| InChIKey | KAOIYXDEVYMICB-UHFFFAOYSA-N |
| XLogP | 12.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.65 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|