C38H25F9O — CID 134371371
1-[2-[4-(4-butyl-2-fluorophenyl)phenyl]ethynyl]-4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-fluoro-2-methylbenzene (PubChem CID 134371371) has the molecular formula C38H25F9O and a molecular weight of 668.60 g/mol. Its IUPAC name is 1-[2-[4-(4-butyl-2-fluorophenyl)phenyl]ethynyl]-4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-fluoro-2-methylbenzene.
| Compound Name | 1-[2-[4-(4-butyl-2-fluorophenyl)phenyl]ethynyl]-4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-fluoro-2-methylbenzene |
|---|---|
| PubChem CID | 134371371 |
| Molecular Formula | C38H25F9O |
| Molecular Weight | 668.60 g/mol |
| Exact Mass | 668.18 |
| IUPAC Name | 1-[2-[4-(4-butyl-2-fluorophenyl)phenyl]ethynyl]-4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-fluoro-2-methylbenzene |
| SMILES | CCCCc1ccc(-c2ccc(C#Cc3cc(F)c(-c4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)cc3C)cc2)c(F)c1 |
| InChI | InChI=1S/C38H25F9O/c1-3-4-5-23-9-13-28(30(39)15-23)24-10-6-22(7-11-24)8-12-25-16-31(40)29(14-21(25)2)26-17-32(41)36(33(42)18-26)38(46,47)48-27-19-34(43)37(45)35(44)20-27/h6-7,9-11,13-20H,3-5H2,1-2H3 |
| InChIKey | JMJOISVQHODEOW-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.60 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|