C28H14F8O — CID 134377830
1-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-5-fluoro-2-methyl-4-phenylbenzene (PubChem CID 134377830) has the molecular formula C28H14F8O and a molecular weight of 518.40 g/mol. Its IUPAC name is 1-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-5-fluoro-2-methyl-4-phenylbenzene.
| Compound Name | 1-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-5-fluoro-2-methyl-4-phenylbenzene |
|---|---|
| PubChem CID | 134377830 |
| Molecular Formula | C28H14F8O |
| Molecular Weight | 518.40 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | 1-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-5-fluoro-2-methyl-4-phenylbenzene |
| SMILES | Cc1cc(-c2ccccc2)c(F)cc1C#Cc1cc(F)c(C(F)(F)Oc2cc(F)c(F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C28H14F8O/c1-15-9-20(17-5-3-2-4-6-17)21(29)12-18(15)8-7-16-10-22(30)26(23(31)11-16)28(35,36)37-19-13-24(32)27(34)25(33)14-19/h2-6,9-14H,1H3 |
| InChIKey | VYBBTGLNQMAYSZ-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.40 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|