C38H28F6 — CID 134371370
1,2,3-trifluoro-5-[2-fluoro-4-[2-fluoro-4-[2-[4-(2-fluoro-4-pentylphenyl)phenyl]ethynyl]-5-methylphenyl]phenyl]benzene (PubChem CID 134371370) has the molecular formula C38H28F6 and a molecular weight of 598.63 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[2-fluoro-4-[2-fluoro-4-[2-[4-(2-fluoro-4-pentylphenyl)phenyl]ethynyl]-5-methylphenyl]phenyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[2-fluoro-4-[2-fluoro-4-[2-[4-(2-fluoro-4-pentylphenyl)phenyl]ethynyl]-5-methylphenyl]phenyl]benzene |
|---|---|
| PubChem CID | 134371370 |
| Molecular Formula | C38H28F6 |
| Molecular Weight | 598.63 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | 1,2,3-trifluoro-5-[2-fluoro-4-[2-fluoro-4-[2-[4-(2-fluoro-4-pentylphenyl)phenyl]ethynyl]-5-methylphenyl]phenyl]benzene |
| SMILES | CCCCCc1ccc(-c2ccc(C#Cc3cc(F)c(-c4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)cc3C)cc2)c(F)c1 |
| InChI | InChI=1S/C38H28F6/c1-3-4-5-6-25-10-15-30(33(39)18-25)26-11-7-24(8-12-26)9-13-27-19-35(41)32(17-23(27)2)28-14-16-31(34(40)20-28)29-21-36(42)38(44)37(43)22-29/h7-8,10-12,14-22H,3-6H2,1-2H3 |
| InChIKey | PXMZOFOCWXLRLU-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.63 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|