C38H27F7 — CID 134371361
2-(3,4-difluorophenyl)-1,3-difluoro-5-[2-[2-fluoro-4-[2-fluoro-4-(2-fluoro-4-pentylphenyl)phenyl]-6-methylphenyl]ethynyl]benzene (PubChem CID 134371361) has the molecular formula C38H27F7 and a molecular weight of 616.62 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-1,3-difluoro-5-[2-[2-fluoro-4-[2-fluoro-4-(2-fluoro-4-pentylphenyl)phenyl]-6-methylphenyl]ethynyl]benzene.
| Compound Name | 2-(3,4-difluorophenyl)-1,3-difluoro-5-[2-[2-fluoro-4-[2-fluoro-4-(2-fluoro-4-pentylphenyl)phenyl]-6-methylphenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 134371361 |
| Molecular Formula | C38H27F7 |
| Molecular Weight | 616.62 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | 2-(3,4-difluorophenyl)-1,3-difluoro-5-[2-[2-fluoro-4-[2-fluoro-4-(2-fluoro-4-pentylphenyl)phenyl]-6-methylphenyl]ethynyl]benzene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3cc(C)c(C#Cc4cc(F)c(-c5ccc(F)c(F)c5)c(F)c4)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C38H27F7/c1-3-4-5-6-23-7-12-29(32(40)16-23)25-9-13-30(34(42)19-25)27-15-22(2)28(33(41)21-27)11-8-24-17-36(44)38(37(45)18-24)26-10-14-31(39)35(43)20-26/h7,9-10,12-21H,3-6H2,1-2H3 |
| InChIKey | DYKAEYTXWOMBKE-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.62 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|