C31H23F7 — CID 139847325
6-[2-[2,6-difluoro-4-(2-fluoro-4-heptylphenyl)phenyl]ethynyl]-1,2,3,8-tetrafluoronaphthalene (PubChem CID 139847325) has the molecular formula C31H23F7 and a molecular weight of 528.51 g/mol. Its IUPAC name is 6-[2-[2,6-difluoro-4-(2-fluoro-4-heptylphenyl)phenyl]ethynyl]-1,2,3,8-tetrafluoronaphthalene.
| Compound Name | 6-[2-[2,6-difluoro-4-(2-fluoro-4-heptylphenyl)phenyl]ethynyl]-1,2,3,8-tetrafluoronaphthalene |
|---|---|
| PubChem CID | 139847325 |
| Molecular Formula | C31H23F7 |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 6-[2-[2,6-difluoro-4-(2-fluoro-4-heptylphenyl)phenyl]ethynyl]-1,2,3,8-tetrafluoronaphthalene |
| SMILES | CCCCCCCc1ccc(-c2cc(F)c(C#Cc3cc(F)c4c(F)c(F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C31H23F7/c1-2-3-4-5-6-7-18-8-10-22(24(32)13-18)20-15-25(33)23(26(34)16-20)11-9-19-12-21-17-28(36)30(37)31(38)29(21)27(35)14-19/h8,10,12-17H,2-7H2,1H3 |
| InChIKey | NNIMFELCHDHMJN-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|