C31H25F5 — CID 139846887
1,2,3-trifluoro-6-[2-[2-fluoro-4-(2-fluoro-4-heptylphenyl)phenyl]ethynyl]naphthalene (PubChem CID 139846887) has the molecular formula C31H25F5 and a molecular weight of 492.53 g/mol. Its IUPAC name is 1,2,3-trifluoro-6-[2-[2-fluoro-4-(2-fluoro-4-heptylphenyl)phenyl]ethynyl]naphthalene.
| Compound Name | 1,2,3-trifluoro-6-[2-[2-fluoro-4-(2-fluoro-4-heptylphenyl)phenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 139846887 |
| Molecular Formula | C31H25F5 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 1,2,3-trifluoro-6-[2-[2-fluoro-4-(2-fluoro-4-heptylphenyl)phenyl]ethynyl]naphthalene |
| SMILES | CCCCCCCc1ccc(-c2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C31H25F5/c1-2-3-4-5-6-7-20-9-14-25(28(33)17-20)23-13-12-22(27(32)18-23)11-8-21-10-15-26-24(16-21)19-29(34)31(36)30(26)35/h9-10,12-19H,2-7H2,1H3 |
| InChIKey | QWEVYYMBXNFTJB-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|