C25H20F6O — CID 142637977
1,3-difluoro-6-[2-(2-fluoro-4-hexylphenyl)ethynyl]-2-(trifluoromethoxy)naphthalene (PubChem CID 142637977) has the molecular formula C25H20F6O and a molecular weight of 450.42 g/mol. Its IUPAC name is 1,3-difluoro-6-[2-(2-fluoro-4-hexylphenyl)ethynyl]-2-(trifluoromethoxy)naphthalene.
| Compound Name | 1,3-difluoro-6-[2-(2-fluoro-4-hexylphenyl)ethynyl]-2-(trifluoromethoxy)naphthalene |
|---|---|
| PubChem CID | 142637977 |
| Molecular Formula | C25H20F6O |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 1,3-difluoro-6-[2-(2-fluoro-4-hexylphenyl)ethynyl]-2-(trifluoromethoxy)naphthalene |
| SMILES | CCCCCCc1ccc(C#Cc2ccc3c(F)c(OC(F)(F)F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C25H20F6O/c1-2-3-4-5-6-16-7-10-18(21(26)14-16)11-8-17-9-12-20-19(13-17)15-22(27)24(23(20)28)32-25(29,30)31/h7,9-10,12-15H,2-6H2,1H3 |
| InChIKey | ITWRHXMQLGBCCP-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|