C29H23F5O — CID 139884152
2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-7-hexylphenanthrene (PubChem CID 139884152) has the molecular formula C29H23F5O and a molecular weight of 482.49 g/mol. Its IUPAC name is 2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-7-hexylphenanthrene.
| Compound Name | 2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-7-hexylphenanthrene |
|---|---|
| PubChem CID | 139884152 |
| Molecular Formula | C29H23F5O |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-7-hexylphenanthrene |
| SMILES | CCCCCCc1ccc2c(ccc3cc(C#Cc4cc(F)c(OC(F)(F)F)c(F)c4)ccc32)c1 |
| InChI | InChI=1S/C29H23F5O/c1-2-3-4-5-6-19-9-13-24-22(15-19)11-12-23-16-20(10-14-25(23)24)7-8-21-17-26(30)28(27(31)18-21)35-29(32,33)34/h9-18H,2-6H2,1H3 |
| InChIKey | RIWWBACYBDANKZ-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|