C29H25F5O — CID 139883406
2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-7-heptyl-9H-fluorene (PubChem CID 139883406) has the molecular formula C29H25F5O and a molecular weight of 484.51 g/mol. Its IUPAC name is 2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-7-heptyl-9H-fluorene.
| Compound Name | 2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-7-heptyl-9H-fluorene |
|---|---|
| PubChem CID | 139883406 |
| Molecular Formula | C29H25F5O |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-7-heptyl-9H-fluorene |
| SMILES | CCCCCCCc1ccc2c(c1)Cc1cc(C#Cc3cc(F)c(OC(F)(F)F)c(F)c3)ccc1-2 |
| InChI | InChI=1S/C29H25F5O/c1-2-3-4-5-6-7-19-10-12-24-22(14-19)18-23-15-20(11-13-25(23)24)8-9-21-16-26(30)28(27(31)17-21)35-29(32,33)34/h10-17H,2-7,18H2,1H3 |
| InChIKey | DLRDCWYUJATRDN-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|