C25H18F4 — CID 22045166
2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethynyl]-7-propyl-9H-fluorene (PubChem CID 22045166) has the molecular formula C25H18F4 and a molecular weight of 394.41 g/mol. Its IUPAC name is 2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethynyl]-7-propyl-9H-fluorene.
| Compound Name | 2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethynyl]-7-propyl-9H-fluorene |
|---|---|
| PubChem CID | 22045166 |
| Molecular Formula | C25H18F4 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethynyl]-7-propyl-9H-fluorene |
| SMILES | CCCc1ccc2c(c1)Cc1cc(C#Cc3ccc(C(F)(F)F)c(F)c3)ccc1-2 |
| InChI | InChI=1S/C25H18F4/c1-2-3-16-6-9-21-19(12-16)15-20-13-17(7-10-22(20)21)4-5-18-8-11-23(24(26)14-18)25(27,28)29/h6-14H,2-3,15H2,1H3 |
| InChIKey | ITCJAJPEYJNGDP-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|