C27H24F6 — CID 139883768
1,3-difluoro-2-[3-fluoro-4-(trifluoromethyl)phenyl]-7-heptyl-9H-fluorene (PubChem CID 139883768) has the molecular formula C27H24F6 and a molecular weight of 462.48 g/mol. Its IUPAC name is 1,3-difluoro-2-[3-fluoro-4-(trifluoromethyl)phenyl]-7-heptyl-9H-fluorene.
| Compound Name | 1,3-difluoro-2-[3-fluoro-4-(trifluoromethyl)phenyl]-7-heptyl-9H-fluorene |
|---|---|
| PubChem CID | 139883768 |
| Molecular Formula | C27H24F6 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 1,3-difluoro-2-[3-fluoro-4-(trifluoromethyl)phenyl]-7-heptyl-9H-fluorene |
| SMILES | CCCCCCCc1ccc2c(c1)Cc1c-2cc(F)c(-c2ccc(C(F)(F)F)c(F)c2)c1F |
| InChI | InChI=1S/C27H24F6/c1-2-3-4-5-6-7-16-8-10-19-18(12-16)13-21-20(19)15-24(29)25(26(21)30)17-9-11-22(23(28)14-17)27(31,32)33/h8-12,14-15H,2-7,13H2,1H3 |
| InChIKey | UUSIGPYJFJSUPL-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|