C25H21F5O — CID 139884348
1,3-difluoro-7-pentyl-2-[4-(trifluoromethoxy)phenyl]-9H-fluorene (PubChem CID 139884348) has the molecular formula C25H21F5O and a molecular weight of 432.43 g/mol. Its IUPAC name is 1,3-difluoro-7-pentyl-2-[4-(trifluoromethoxy)phenyl]-9H-fluorene.
| Compound Name | 1,3-difluoro-7-pentyl-2-[4-(trifluoromethoxy)phenyl]-9H-fluorene |
|---|---|
| PubChem CID | 139884348 |
| Molecular Formula | C25H21F5O |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 1,3-difluoro-7-pentyl-2-[4-(trifluoromethoxy)phenyl]-9H-fluorene |
| SMILES | CCCCCc1ccc2c(c1)Cc1c-2cc(F)c(-c2ccc(OC(F)(F)F)cc2)c1F |
| InChI | InChI=1S/C25H21F5O/c1-2-3-4-5-15-6-11-19-17(12-15)13-21-20(19)14-22(26)23(24(21)27)16-7-9-18(10-8-16)31-25(28,29)30/h6-12,14H,2-5,13H2,1H3 |
| InChIKey | OBJNQEZMFFLSED-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|