C22H16F4O — CID 139884145
2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene (PubChem CID 139884145) has the molecular formula C22H16F4O and a molecular weight of 372.36 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene.
| Compound Name | 2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene |
|---|---|
| PubChem CID | 139884145 |
| Molecular Formula | C22H16F4O |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene |
| SMILES | CCc1ccc2c(c1)Cc1c-2cc(F)c(-c2ccc(OC(F)F)cc2)c1F |
| InChI | InChI=1S/C22H16F4O/c1-2-12-3-8-16-14(9-12)10-18-17(16)11-19(23)20(21(18)24)13-4-6-15(7-5-13)27-22(25)26/h3-9,11,22H,2,10H2,1H3 |
| InChIKey | XNNVZAAGRGGYSH-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |