About 2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene
2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene (PubChem CID 139884145) has the molecular formula C22H16F4O
and a molecular weight of 372.36 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene.
Molecular Properties
| Compound Name | 2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene |
| PubChem CID | 139884145 |
| Molecular Formula | C22H16F4O |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene |
| SMILES | CCc1ccc2c(c1)Cc1c-2cc(F)c(-c2ccc(OC(F)F)cc2)c1F |
| InChI | InChI=1S/C22H16F4O/c1-2-12-3-8-16-14(9-12)10-18-17(16)11-19(23)20(21(18)24)13-4-6-15(7-5-13)27-22(25)26/h3-9,11,22H,2,10H2,1H3 |
| InChIKey | XNNVZAAGRGGYSH-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene?
The IUPAC name of 2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene (CID 139884145) is 2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene.
What is the SMILES notation for 2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene?
The canonical SMILES for 2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene is CCc1ccc2c(c1)Cc1c-2cc(F)c(-c2ccc(OC(F)F)cc2)c1F.
What is the InChIKey of 2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene?
The InChIKey is XNNVZAAGRGGYSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16F4O/c1-2-12-3-8-16-14(9-12)10-18-17(16)11-19(23)20(21(18)24)13-4-6-15(7-5-13)27-22(25)26/h3-9,11,22H,2,10H2,1H3.
What are the key properties of 2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene?
2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene has a molecular weight of 372.36 g/mol, XLogP of 6.37, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(difluoromethoxy)phenyl]-7-ethyl-1,3-difluoro-9H-fluorene is sourced from PubChem (CID 139884145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).