C21H14F4 — CID 139883301
7-ethyl-1-fluoro-2-(3,4,5-trifluorophenyl)-9H-fluorene (PubChem CID 139883301) has the molecular formula C21H14F4 and a molecular weight of 342.34 g/mol. Its IUPAC name is 7-ethyl-1-fluoro-2-(3,4,5-trifluorophenyl)-9H-fluorene.
| Compound Name | 7-ethyl-1-fluoro-2-(3,4,5-trifluorophenyl)-9H-fluorene |
|---|---|
| PubChem CID | 139883301 |
| Molecular Formula | C21H14F4 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 7-ethyl-1-fluoro-2-(3,4,5-trifluorophenyl)-9H-fluorene |
| SMILES | CCc1ccc2c(c1)Cc1c-2ccc(-c2cc(F)c(F)c(F)c2)c1F |
| InChI | InChI=1S/C21H14F4/c1-2-11-3-4-14-12(7-11)8-17-16(14)6-5-15(20(17)24)13-9-18(22)21(25)19(23)10-13/h3-7,9-10H,2,8H2,1H3 |
| InChIKey | OYSQZYZOYLVHNI-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|