C25H20F6O2 — CID 134371139
1,3-difluoro-6-[2-(2-fluoro-6-methoxy-4-pentylphenyl)ethynyl]-2-(trifluoromethoxy)naphthalene (PubChem CID 134371139) has the molecular formula C25H20F6O2 and a molecular weight of 466.42 g/mol. Its IUPAC name is 1,3-difluoro-6-[2-(2-fluoro-6-methoxy-4-pentylphenyl)ethynyl]-2-(trifluoromethoxy)naphthalene.
| Compound Name | 1,3-difluoro-6-[2-(2-fluoro-6-methoxy-4-pentylphenyl)ethynyl]-2-(trifluoromethoxy)naphthalene |
|---|---|
| PubChem CID | 134371139 |
| Molecular Formula | C25H20F6O2 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 1,3-difluoro-6-[2-(2-fluoro-6-methoxy-4-pentylphenyl)ethynyl]-2-(trifluoromethoxy)naphthalene |
| SMILES | CCCCCc1cc(F)c(C#Cc2ccc3c(F)c(OC(F)(F)F)c(F)cc3c2)c(OC)c1 |
| InChI | InChI=1S/C25H20F6O2/c1-3-4-5-6-16-12-20(26)19(22(13-16)32-2)10-8-15-7-9-18-17(11-15)14-21(27)24(23(18)28)33-25(29,30)31/h7,9,11-14H,3-6H2,1-2H3 |
| InChIKey | WPVYSPVLWDLLOQ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|