C29H25F7O — CID 87602913
6-[2-[4-(1-butylcyclohexyl)-2,6-difluorophenyl]ethynyl]-1,3-difluoro-2-(trifluoromethoxy)naphthalene (PubChem CID 87602913) has the molecular formula C29H25F7O and a molecular weight of 522.50 g/mol. Its IUPAC name is 6-[2-[4-(1-butylcyclohexyl)-2,6-difluorophenyl]ethynyl]-1,3-difluoro-2-(trifluoromethoxy)naphthalene.
| Compound Name | 6-[2-[4-(1-butylcyclohexyl)-2,6-difluorophenyl]ethynyl]-1,3-difluoro-2-(trifluoromethoxy)naphthalene |
|---|---|
| PubChem CID | 87602913 |
| Molecular Formula | C29H25F7O |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 6-[2-[4-(1-butylcyclohexyl)-2,6-difluorophenyl]ethynyl]-1,3-difluoro-2-(trifluoromethoxy)naphthalene |
| SMILES | CCCCC1(c2cc(F)c(C#Cc3ccc4c(F)c(OC(F)(F)F)c(F)cc4c3)c(F)c2)CCCCC1 |
| InChI | InChI=1S/C29H25F7O/c1-2-3-11-28(12-5-4-6-13-28)20-16-23(30)22(24(31)17-20)10-8-18-7-9-21-19(14-18)15-25(32)27(26(21)33)37-29(34,35)36/h7,9,14-17H,2-6,11-13H2,1H3 |
| InChIKey | WCKWGULZTOTAGW-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|