C26H31F5O — CID 22384538
1,3-difluoro-6-(6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(trifluoromethoxy)naphthalene (PubChem CID 22384538) has the molecular formula C26H31F5O and a molecular weight of 454.52 g/mol. Its IUPAC name is 1,3-difluoro-6-(6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(trifluoromethoxy)naphthalene.
| Compound Name | 1,3-difluoro-6-(6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(trifluoromethoxy)naphthalene |
|---|---|
| PubChem CID | 22384538 |
| Molecular Formula | C26H31F5O |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 1,3-difluoro-6-(6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(trifluoromethoxy)naphthalene |
| SMILES | CCCCCC1CCC2CC(c3ccc4c(F)c(OC(F)(F)F)c(F)cc4c3)CCC2C1 |
| InChI | InChI=1S/C26H31F5O/c1-2-3-4-5-16-6-7-18-13-19(9-8-17(18)12-16)20-10-11-22-21(14-20)15-23(27)25(24(22)28)32-26(29,30)31/h10-11,14-19H,2-9,12-13H2,1H3 |
| InChIKey | PTPAVSFFPDQMNC-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|