C29H38F2O — CID 20807590
6-[(2R,4aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,3-difluoro-2-prop-2-enoxynaphthalene (PubChem CID 20807590) has the molecular formula C29H38F2O and a molecular weight of 440.62 g/mol. Its IUPAC name is 6-[(2R,4aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,3-difluoro-2-prop-2-enoxynaphthalene.
| Compound Name | 6-[(2R,4aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,3-difluoro-2-prop-2-enoxynaphthalene |
|---|---|
| PubChem CID | 20807590 |
| Molecular Formula | C29H38F2O |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 6-[(2R,4aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,3-difluoro-2-prop-2-enoxynaphthalene |
| SMILES | C=CCOc1c(F)cc2cc([C@@H]3CC[C@@H]4CC(CCCCCC)CCC4C3)ccc2c1F |
| InChI | InChI=1S/C29H38F2O/c1-3-5-6-7-8-20-9-10-22-17-23(12-11-21(22)16-20)24-13-14-26-25(18-24)19-27(30)29(28(26)31)32-15-4-2/h4,13-14,18-23H,2-3,5-12,15-17H2,1H3/t20?,21-,22?,23-/m1/s1 |
| InChIKey | HGAAJWXSYUAGTM-LPIJFZEYSA-N |
| XLogP | 8.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|