C25H11F7 — CID 139846854
6-[4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]-2-fluorophenyl]-1,2,3,8-tetrafluoronaphthalene (PubChem CID 139846854) has the molecular formula C25H11F7 and a molecular weight of 444.35 g/mol. Its IUPAC name is 6-[4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]-2-fluorophenyl]-1,2,3,8-tetrafluoronaphthalene.
| Compound Name | 6-[4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]-2-fluorophenyl]-1,2,3,8-tetrafluoronaphthalene |
|---|---|
| PubChem CID | 139846854 |
| Molecular Formula | C25H11F7 |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 6-[4-[2-(2,6-difluoro-4-methylphenyl)ethynyl]-2-fluorophenyl]-1,2,3,8-tetrafluoronaphthalene |
| SMILES | Cc1cc(F)c(C#Cc2ccc(-c3cc(F)c4c(F)c(F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C25H11F7/c1-12-6-18(26)17(19(27)7-12)5-3-13-2-4-16(20(28)8-13)14-9-15-11-22(30)24(31)25(32)23(15)21(29)10-14/h2,4,6-11H,1H3 |
| InChIKey | FLCXIJWFZOLNAP-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|