C25H13F5 — CID 139859144
2-[2-[4-(2,6-difluoro-4-methylphenyl)-2,6-difluorophenyl]ethynyl]-6-fluoronaphthalene (PubChem CID 139859144) has the molecular formula C25H13F5 and a molecular weight of 408.37 g/mol. Its IUPAC name is 2-[2-[4-(2,6-difluoro-4-methylphenyl)-2,6-difluorophenyl]ethynyl]-6-fluoronaphthalene.
| Compound Name | 2-[2-[4-(2,6-difluoro-4-methylphenyl)-2,6-difluorophenyl]ethynyl]-6-fluoronaphthalene |
|---|---|
| PubChem CID | 139859144 |
| Molecular Formula | C25H13F5 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 2-[2-[4-(2,6-difluoro-4-methylphenyl)-2,6-difluorophenyl]ethynyl]-6-fluoronaphthalene |
| SMILES | Cc1cc(F)c(-c2cc(F)c(C#Cc3ccc4cc(F)ccc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C25H13F5/c1-14-8-23(29)25(24(30)9-14)18-12-21(27)20(22(28)13-18)7-3-15-2-4-17-11-19(26)6-5-16(17)10-15/h2,4-6,8-13H,1H3 |
| InChIKey | XIYWHVZPRLTYDL-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|