C29H21F5 — CID 139857543
2-[2-[4-[2-(2,6-difluoro-4-propylphenyl)ethyl]-2,6-difluorophenyl]ethynyl]-6-fluoronaphthalene (PubChem CID 139857543) has the molecular formula C29H21F5 and a molecular weight of 464.48 g/mol. Its IUPAC name is 2-[2-[4-[2-(2,6-difluoro-4-propylphenyl)ethyl]-2,6-difluorophenyl]ethynyl]-6-fluoronaphthalene.
| Compound Name | 2-[2-[4-[2-(2,6-difluoro-4-propylphenyl)ethyl]-2,6-difluorophenyl]ethynyl]-6-fluoronaphthalene |
|---|---|
| PubChem CID | 139857543 |
| Molecular Formula | C29H21F5 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-[2-[4-[2-(2,6-difluoro-4-propylphenyl)ethyl]-2,6-difluorophenyl]ethynyl]-6-fluoronaphthalene |
| SMILES | CCCc1cc(F)c(CCc2cc(F)c(C#Cc3ccc4cc(F)ccc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C29H21F5/c1-2-3-19-13-26(31)25(27(32)14-19)11-6-20-15-28(33)24(29(34)16-20)10-5-18-4-7-22-17-23(30)9-8-21(22)12-18/h4,7-9,12-17H,2-3,6,11H2,1H3 |
| InChIKey | RBHBEEQMJDJUGX-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|