C27H14F4 — CID 139859176
2-[2-[2,6-difluoro-4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl]ethynyl]-6-fluoronaphthalene (PubChem CID 139859176) has the molecular formula C27H14F4 and a molecular weight of 414.40 g/mol. Its IUPAC name is 2-[2-[2,6-difluoro-4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl]ethynyl]-6-fluoronaphthalene.
| Compound Name | 2-[2-[2,6-difluoro-4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl]ethynyl]-6-fluoronaphthalene |
|---|---|
| PubChem CID | 139859176 |
| Molecular Formula | C27H14F4 |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-[2-[2,6-difluoro-4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl]ethynyl]-6-fluoronaphthalene |
| SMILES | Cc1ccc(C#Cc2cc(F)c(C#Cc3ccc4cc(F)ccc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C27H14F4/c1-17-2-6-20(25(29)12-17)7-4-19-14-26(30)24(27(31)15-19)11-5-18-3-8-22-16-23(28)10-9-21(22)13-18/h2-3,6,8-10,12-16H,1H3 |
| InChIKey | SYFNZWMGONRYKW-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|