C18H17F — CID 20683361
5-[2-(2-fluoro-4-methylphenyl)ethynyl]-1,2,3-trimethylbenzene (PubChem CID 20683361) has the molecular formula C18H17F and a molecular weight of 252.33 g/mol. Its IUPAC name is 5-[2-(2-fluoro-4-methylphenyl)ethynyl]-1,2,3-trimethylbenzene.
| Compound Name | 5-[2-(2-fluoro-4-methylphenyl)ethynyl]-1,2,3-trimethylbenzene |
|---|---|
| PubChem CID | 20683361 |
| Molecular Formula | C18H17F |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 5-[2-(2-fluoro-4-methylphenyl)ethynyl]-1,2,3-trimethylbenzene |
| SMILES | Cc1ccc(C#Cc2cc(C)c(C)c(C)c2)c(F)c1 |
| InChI | InChI=1S/C18H17F/c1-12-5-7-17(18(19)9-12)8-6-16-10-13(2)15(4)14(3)11-16/h5,7,9-11H,1-4H3 |
| InChIKey | XMMNYLKBZYEATQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|