C26H20F2 — CID 21360221
1,3-difluoro-2-methyl-5-[2-[4-[2-(3,4,5-trimethylphenyl)ethynyl]phenyl]ethynyl]benzene (PubChem CID 21360221) has the molecular formula C26H20F2 and a molecular weight of 370.44 g/mol. Its IUPAC name is 1,3-difluoro-2-methyl-5-[2-[4-[2-(3,4,5-trimethylphenyl)ethynyl]phenyl]ethynyl]benzene.
| Compound Name | 1,3-difluoro-2-methyl-5-[2-[4-[2-(3,4,5-trimethylphenyl)ethynyl]phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 21360221 |
| Molecular Formula | C26H20F2 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1,3-difluoro-2-methyl-5-[2-[4-[2-(3,4,5-trimethylphenyl)ethynyl]phenyl]ethynyl]benzene |
| SMILES | Cc1cc(C#Cc2ccc(C#Cc3cc(F)c(C)c(F)c3)cc2)cc(C)c1C |
| InChI | InChI=1S/C26H20F2/c1-17-13-23(14-18(2)19(17)3)11-9-21-5-7-22(8-6-21)10-12-24-15-25(27)20(4)26(28)16-24/h5-8,13-16H,1-4H3 |
| InChIKey | QJCKJRVSPJUVNU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|