C19H14F2 — CID 54027024
5-ethynyl-1,3-difluoro-2-[2-(3,4,5-trimethylphenyl)ethynyl]benzene (PubChem CID 54027024) has the molecular formula C19H14F2 and a molecular weight of 280.32 g/mol. Its IUPAC name is 5-ethynyl-1,3-difluoro-2-[2-(3,4,5-trimethylphenyl)ethynyl]benzene.
| Compound Name | 5-ethynyl-1,3-difluoro-2-[2-(3,4,5-trimethylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 54027024 |
| Molecular Formula | C19H14F2 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 5-ethynyl-1,3-difluoro-2-[2-(3,4,5-trimethylphenyl)ethynyl]benzene |
| SMILES | C#Cc1cc(F)c(C#Cc2cc(C)c(C)c(C)c2)c(F)c1 |
| InChI | InChI=1S/C19H14F2/c1-5-15-10-18(20)17(19(21)11-15)7-6-16-8-12(2)14(4)13(3)9-16/h1,8-11H,2-4H3 |
| InChIKey | LCXJWCDOZORRDO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|