C8H3ClF2 — CID 139677428
2-chloro-5-ethynyl-1,3-difluorobenzene (PubChem CID 139677428) has the molecular formula C8H3ClF2 and a molecular weight of 172.56 g/mol. Its IUPAC name is 2-chloro-5-ethynyl-1,3-difluorobenzene.
| Compound Name | 2-chloro-5-ethynyl-1,3-difluorobenzene |
|---|---|
| PubChem CID | 139677428 |
| Molecular Formula | C8H3ClF2 |
| Molecular Weight | 172.56 g/mol |
| Exact Mass | 171.99 |
| IUPAC Name | 2-chloro-5-ethynyl-1,3-difluorobenzene |
| SMILES | C#Cc1cc(F)c(Cl)c(F)c1 |
| InChI | InChI=1S/C8H3ClF2/c1-2-5-3-6(10)8(9)7(11)4-5/h1,3-4H |
| InChIKey | WAEFVVJPHTWNAT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.56 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|