C9H3F5 — CID 151290666
5-ethynyl-1,3-difluoro-2-(trifluoromethyl)benzene (PubChem CID 151290666) has the molecular formula C9H3F5 and a molecular weight of 206.11 g/mol. Its IUPAC name is 5-ethynyl-1,3-difluoro-2-(trifluoromethyl)benzene.
| Compound Name | 5-ethynyl-1,3-difluoro-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 151290666 |
| Molecular Formula | C9H3F5 |
| Molecular Weight | 206.11 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 5-ethynyl-1,3-difluoro-2-(trifluoromethyl)benzene |
| SMILES | C#Cc1cc(F)c(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C9H3F5/c1-2-5-3-6(10)8(7(11)4-5)9(12,13)14/h1,3-4H |
| InChIKey | OAJBFLSMQMFHRO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.11 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|