C7H2F5NO2 — CID 57432868
1,3-difluoro-5-nitro-2-(trifluoromethyl)benzene (PubChem CID 57432868) has the molecular formula C7H2F5NO2 and a molecular weight of 227.09 g/mol. Its IUPAC name is 1,3-difluoro-5-nitro-2-(trifluoromethyl)benzene.
| Compound Name | 1,3-difluoro-5-nitro-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 57432868 |
| Molecular Formula | C7H2F5NO2 |
| Molecular Weight | 227.09 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | 1,3-difluoro-5-nitro-2-(trifluoromethyl)benzene |
| SMILES | O=[N+]([O-])c1cc(F)c(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C7H2F5NO2/c8-4-1-3(13(14)15)2-5(9)6(4)7(10,11)12/h1-2H |
| InChIKey | DNMOSHKONPLIAK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.09 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|