C6H4F2NO2P — CID 142842521
(2,3-difluoro-5-nitrophenyl)phosphane (PubChem CID 142842521) has the molecular formula C6H4F2NO2P and a molecular weight of 191.07 g/mol. Its IUPAC name is (2,3-difluoro-5-nitrophenyl)phosphane.
| Compound Name | (2,3-difluoro-5-nitrophenyl)phosphane |
|---|---|
| PubChem CID | 142842521 |
| Molecular Formula | C6H4F2NO2P |
| Molecular Weight | 191.07 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | (2,3-difluoro-5-nitrophenyl)phosphane |
| SMILES | O=[N+]([O-])c1cc(F)c(F)c(P)c1 |
| InChI | InChI=1S/C6H4F2NO2P/c7-4-1-3(9(10)11)2-5(12)6(4)8/h1-2H,12H2 |
| InChIKey | OXLMLNASLNGIAE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.07 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|