C6H4BF2NO5 — CID 142727375
(2,3-difluoro-5-nitrophenoxy)boronic acid (PubChem CID 142727375) has the molecular formula C6H4BF2NO5 and a molecular weight of 218.91 g/mol. Its IUPAC name is (2,3-difluoro-5-nitrophenoxy)boronic acid.
| Compound Name | (2,3-difluoro-5-nitrophenoxy)boronic acid |
|---|---|
| PubChem CID | 142727375 |
| Molecular Formula | C6H4BF2NO5 |
| Molecular Weight | 218.91 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | (2,3-difluoro-5-nitrophenoxy)boronic acid |
| SMILES | O=[N+]([O-])c1cc(F)c(F)c(OB(O)O)c1 |
| InChI | InChI=1S/C6H4BF2NO5/c8-4-1-3(10(13)14)2-5(6(4)9)15-7(11)12/h1-2,11-12H |
| InChIKey | WJQHTIGFHKOXKT-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.91 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|