(2,3-difluoro-5-nitrophenoxy)boronic acid

C6H4BF2NO5 — CID 142727375

IUPAC(2,3-difluoro-5-nitrophenoxy)boronic acid
SMILESO=[N+]([O-])c1cc(F)c(F)c(OB(O)O)c1
InChIInChI=1S/C6H4BF2NO5/c8-4-1-3(10(13)14)2-5(6(4)9)15-7(11)12/h1-2,11-12H
InChIKeyWJQHTIGFHKOXKT-UHFFFAOYSA-N
MW218.91 g/mol
LogP0.22
Rot. Bonds3

About (2,3-difluoro-5-nitrophenoxy)boronic acid

(2,3-difluoro-5-nitrophenoxy)boronic acid (PubChem CID 142727375) has the molecular formula C6H4BF2NO5 and a molecular weight of 218.91 g/mol. Its IUPAC name is (2,3-difluoro-5-nitrophenoxy)boronic acid.

Molecular Properties

Compound Name(2,3-difluoro-5-nitrophenoxy)boronic acid
PubChem CID142727375
Molecular FormulaC6H4BF2NO5
Molecular Weight218.91 g/mol
Exact Mass219.02
IUPAC Name(2,3-difluoro-5-nitrophenoxy)boronic acid
SMILESO=[N+]([O-])c1cc(F)c(F)c(OB(O)O)c1
InChIInChI=1S/C6H4BF2NO5/c8-4-1-3(10(13)14)2-5(6(4)9)15-7(11)12/h1-2,11-12H
InChIKeyWJQHTIGFHKOXKT-UHFFFAOYSA-N
XLogP0.22
TPSA92.83 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.91
LogP ≤ 50.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2,3-difluoro-5-nitrophenoxy)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,3-difluoro-5-nitrophenoxy)boronic acid?
The IUPAC name of (2,3-difluoro-5-nitrophenoxy)boronic acid (CID 142727375) is (2,3-difluoro-5-nitrophenoxy)boronic acid.
What is the SMILES notation for (2,3-difluoro-5-nitrophenoxy)boronic acid?
The canonical SMILES for (2,3-difluoro-5-nitrophenoxy)boronic acid is O=[N+]([O-])c1cc(F)c(F)c(OB(O)O)c1.
What is the InChIKey of (2,3-difluoro-5-nitrophenoxy)boronic acid?
The InChIKey is WJQHTIGFHKOXKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BF2NO5/c8-4-1-3(10(13)14)2-5(6(4)9)15-7(11)12/h1-2,11-12H.
What are the key properties of (2,3-difluoro-5-nitrophenoxy)boronic acid?
(2,3-difluoro-5-nitrophenoxy)boronic acid has a molecular weight of 218.91 g/mol, XLogP of 0.22, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-difluoro-5-nitrophenoxy)boronic acid is sourced from PubChem (CID 142727375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).